C10H8Cl2N4OS — CID 879248
1-(3,4-dichlorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 879248) has the molecular formula C10H8Cl2N4OS and a molecular weight of 303.17 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 879248 |
| Molecular Formula | C10H8Cl2N4OS |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | Cc1nnc(NC(=O)Nc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C10H8Cl2N4OS/c1-5-15-16-10(18-5)14-9(17)13-6-2-3-7(11)8(12)4-6/h2-4H,1H3,(H2,13,14,16,17) |
| InChIKey | KKCIUUSCUVLEQK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |