C22H26N2O7S — CID 87924822
[12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl]-thiophen-3-ylcarbamic acid (PubChem CID 87924822) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is [12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl]-thiophen-3-ylcarbamic acid.
| Compound Name | [12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl]-thiophen-3-ylcarbamic acid |
|---|---|
| PubChem CID | 87924822 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl]-thiophen-3-ylcarbamic acid |
| SMILES | CC1C(=O)OC2CC3(C)OC3C(N(C(=O)O)c3ccsc3)C(N(C)C)C3=CC(OC3=O)C21 |
| InChI | InChI=1S/C22H26N2O7S/c1-10-15-13-7-12(20(26)29-13)16(23(3)4)17(24(21(27)28)11-5-6-32-9-11)18-22(2,31-18)8-14(15)30-19(10)25/h5-7,9-10,13-18H,8H2,1-4H3,(H,27,28) |
| InChIKey | LFOLANHPYLKEST-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|