About 2-ethenyloxirane;2-methoxybut-3-en-1-ol
2-ethenyloxirane;2-methoxybut-3-en-1-ol (PubChem CID 87924948) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-ethenyloxirane;2-methoxybut-3-en-1-ol.
Molecular Properties
| Compound Name | 2-ethenyloxirane;2-methoxybut-3-en-1-ol |
| PubChem CID | 87924948 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-ethenyloxirane;2-methoxybut-3-en-1-ol |
| SMILES | C=CC(CO)OC.C=CC1CO1 |
| InChI | InChI=1S/C5H10O2.C4H6O/c1-3-5(4-6)7-2;1-2-4-3-5-4/h3,5-6H,1,4H2,2H3;2,4H,1,3H2 |
| InChIKey | HLCXXAKECVNYFK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyloxirane;2-methoxybut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyloxirane;2-methoxybut-3-en-1-ol?
The IUPAC name of 2-ethenyloxirane;2-methoxybut-3-en-1-ol (CID 87924948) is 2-ethenyloxirane;2-methoxybut-3-en-1-ol.
What is the SMILES notation for 2-ethenyloxirane;2-methoxybut-3-en-1-ol?
The canonical SMILES for 2-ethenyloxirane;2-methoxybut-3-en-1-ol is C=CC(CO)OC.C=CC1CO1.
What is the InChIKey of 2-ethenyloxirane;2-methoxybut-3-en-1-ol?
The InChIKey is HLCXXAKECVNYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C4H6O/c1-3-5(4-6)7-2;1-2-4-3-5-4/h3,5-6H,1,4H2,2H3;2,4H,1,3H2.
What are the key properties of 2-ethenyloxirane;2-methoxybut-3-en-1-ol?
2-ethenyloxirane;2-methoxybut-3-en-1-ol has a molecular weight of 172.22 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyloxirane;2-methoxybut-3-en-1-ol is sourced from PubChem (CID 87924948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).