C19H16F12O11 — CID 87924974
[6-methoxy-3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]hexyl] 2-methylprop-2-enoate (PubChem CID 87924974) has the molecular formula C19H16F12O11 and a molecular weight of 648.30 g/mol. Its IUPAC name is [6-methoxy-3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]hexyl] 2-methylprop-2-enoate.
| Compound Name | [6-methoxy-3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]hexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87924974 |
| Molecular Formula | C19H16F12O11 |
| Molecular Weight | 648.30 g/mol |
| Exact Mass | 648.05 |
| IUPAC Name | [6-methoxy-3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]hexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(OC)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H16F12O11/c1-6(2)10(32)38-5-4-7(39-12(33)16(20,21)22)8(40-13(34)17(23,24)25)9(41-14(35)18(26,27)28)11(37-3)42-15(36)19(29,30)31/h7-9,11H,1,4-5H2,2-3H3 |
| InChIKey | AXSYPTCMXPRRGT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|