About 1-ethynyl-1,2-difluorocyclohexane
1-ethynyl-1,2-difluorocyclohexane (PubChem CID 87925061) has the molecular formula C8H10F2
and a molecular weight of 144.16 g/mol. Its IUPAC name is 1-ethynyl-1,2-difluorocyclohexane.
Molecular Properties
| Compound Name | 1-ethynyl-1,2-difluorocyclohexane |
| PubChem CID | 87925061 |
| Molecular Formula | C8H10F2 |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 1-ethynyl-1,2-difluorocyclohexane |
| SMILES | C#CC1(F)CCCCC1F |
| InChI | InChI=1S/C8H10F2/c1-2-8(10)6-4-3-5-7(8)9/h1,7H,3-6H2 |
| InChIKey | YQLXAGOCGJIRHO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-1,2-difluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-1,2-difluorocyclohexane?
The IUPAC name of 1-ethynyl-1,2-difluorocyclohexane (CID 87925061) is 1-ethynyl-1,2-difluorocyclohexane.
What is the SMILES notation for 1-ethynyl-1,2-difluorocyclohexane?
The canonical SMILES for 1-ethynyl-1,2-difluorocyclohexane is C#CC1(F)CCCCC1F.
What is the InChIKey of 1-ethynyl-1,2-difluorocyclohexane?
The InChIKey is YQLXAGOCGJIRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2/c1-2-8(10)6-4-3-5-7(8)9/h1,7H,3-6H2.
What are the key properties of 1-ethynyl-1,2-difluorocyclohexane?
1-ethynyl-1,2-difluorocyclohexane has a molecular weight of 144.16 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-1,2-difluorocyclohexane is sourced from PubChem (CID 87925061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).