C15H14Cl3N2O5+ — CID 87925118
hydroxy-methyl-[[2,5,6-trichloro-4-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]indol-3-ylidene]methylidene]azanium (PubChem CID 87925118) has the molecular formula C15H14Cl3N2O5+ and a molecular weight of 408.65 g/mol. Its IUPAC name is hydroxy-methyl-[[2,5,6-trichloro-4-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]indol-3-ylidene]methylidene]azanium.
| Compound Name | hydroxy-methyl-[[2,5,6-trichloro-4-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]indol-3-ylidene]methylidene]azanium |
|---|---|
| PubChem CID | 87925118 |
| Molecular Formula | C15H14Cl3N2O5+ |
| Molecular Weight | 408.65 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | hydroxy-methyl-[[2,5,6-trichloro-4-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]indol-3-ylidene]methylidene]azanium |
| SMILES | C[N+](O)=C=C1C(Cl)=Nc2cc(Cl)c(Cl)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C15H14Cl3N2O5/c1-20(24)3-5-9-7(19-15(5)18)2-6(16)11(17)10(9)14-13(23)12(22)8(4-21)25-14/h2,8,12-14,21-24H,4H2,1H3/q+1/t8-,12-,13-,14+/m1/s1 |
| InChIKey | UXKWCKMLEGQLDA-OJICRYGUSA-N |
| XLogP | 1.51 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.65 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|