C20H33NO — CID 87925146
(NE)-N-[[(1R,4aR,7S)-7-ethyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methylidene]hydroxylamine (PubChem CID 87925146) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is (NE)-N-[[(1R,4aR,7S)-7-ethyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[(1R,4aR,7S)-7-ethyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 87925146 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | (NE)-N-[[(1R,4aR,7S)-7-ethyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methylidene]hydroxylamine |
| SMILES | CC[C@@]1(C)CC=C2C(CCC3[C@@]2(C)CCC[C@@]3(C)/C=N/O)C1 |
| InChI | InChI=1S/C20H33NO/c1-5-18(2)12-9-16-15(13-18)7-8-17-19(3,14-21-22)10-6-11-20(16,17)4/h9,14-15,17,22H,5-8,10-13H2,1-4H3/b21-14+/t15?,17?,18-,19-,20-/m0/s1 |
| InChIKey | HIGTWEYFZPITKS-ORCHOVTOSA-N |
| XLogP | 5.81 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|