C16H16Cl3N3O4 — CID 87925147
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-[2,5,6-trichloro-3-[(dimethylhydrazinylidene)methylidene]indol-4-yl]oxolane-3,4-diol (PubChem CID 87925147) has the molecular formula C16H16Cl3N3O4 and a molecular weight of 420.68 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[2,5,6-trichloro-3-[(dimethylhydrazinylidene)methylidene]indol-4-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[2,5,6-trichloro-3-[(dimethylhydrazinylidene)methylidene]indol-4-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 87925147 |
| Molecular Formula | C16H16Cl3N3O4 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[2,5,6-trichloro-3-[(dimethylhydrazinylidene)methylidene]indol-4-yl]oxolane-3,4-diol |
| SMILES | CN(C)N=C=C1C(Cl)=Nc2cc(Cl)c(Cl)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C16H16Cl3N3O4/c1-22(2)20-4-6-10-8(21-16(6)19)3-7(17)12(18)11(10)15-14(25)13(24)9(5-23)26-15/h3,9,13-15,23-25H,5H2,1-2H3/t9-,13-,14-,15+/m1/s1 |
| InChIKey | TYKCOFPVMZBMLY-QUAZDUCUSA-N |
| XLogP | 1.96 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|