C7F10O3 — CID 87925233
3,4,4,5-tetrafluoro-3,5-bis(trifluoromethyl)oxane-2,6-dione (PubChem CID 87925233) has the molecular formula C7F10O3 and a molecular weight of 322.05 g/mol. Its IUPAC name is 3,4,4,5-tetrafluoro-3,5-bis(trifluoromethyl)oxane-2,6-dione.
| Compound Name | 3,4,4,5-tetrafluoro-3,5-bis(trifluoromethyl)oxane-2,6-dione |
|---|---|
| PubChem CID | 87925233 |
| Molecular Formula | C7F10O3 |
| Molecular Weight | 322.05 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 3,4,4,5-tetrafluoro-3,5-bis(trifluoromethyl)oxane-2,6-dione |
| SMILES | O=C1OC(=O)C(F)(C(F)(F)F)C(F)(F)C1(F)C(F)(F)F |
| InChI | InChI=1S/C7F10O3/c8-3(6(12,13)14)1(18)20-2(19)4(9,5(3,10)11)7(15,16)17 |
| InChIKey | XIGYHUVPPTZARN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.05 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|