C20H24N4O3Si — CID 87925267
3-nitroso-1'-(2-trimethylsilylethoxymethyl)spiro[5,7-dihydrocyclopenta[b]pyridine-6,3'-pyrrolo[2,3-b]pyridine]-2'-one (PubChem CID 87925267) has the molecular formula C20H24N4O3Si and a molecular weight of 396.52 g/mol. Its IUPAC name is 3-nitroso-1'-(2-trimethylsilylethoxymethyl)spiro[5,7-dihydrocyclopenta[b]pyridine-6,3'-pyrrolo[2,3-b]pyridine]-2'-one.
| Compound Name | 3-nitroso-1'-(2-trimethylsilylethoxymethyl)spiro[5,7-dihydrocyclopenta[b]pyridine-6,3'-pyrrolo[2,3-b]pyridine]-2'-one |
|---|---|
| PubChem CID | 87925267 |
| Molecular Formula | C20H24N4O3Si |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-nitroso-1'-(2-trimethylsilylethoxymethyl)spiro[5,7-dihydrocyclopenta[b]pyridine-6,3'-pyrrolo[2,3-b]pyridine]-2'-one |
| SMILES | C[Si](C)(C)CCOCN1C(=O)C2(Cc3cc(N=O)cnc3C2)c2cccnc21 |
| InChI | InChI=1S/C20H24N4O3Si/c1-28(2,3)8-7-27-13-24-18-16(5-4-6-21-18)20(19(24)25)10-14-9-15(23-26)12-22-17(14)11-20/h4-6,9,12H,7-8,10-11,13H2,1-3H3 |
| InChIKey | GQLKEZWHCIJXPA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|