C14H20N2O3S2 — CID 87925339
2-(3-amino-2H-1,3-thiazol-2-yl)ethyl 2,4,6-trimethylbenzenesulfonate (PubChem CID 87925339) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-(3-amino-2H-1,3-thiazol-2-yl)ethyl 2,4,6-trimethylbenzenesulfonate.
| Compound Name | 2-(3-amino-2H-1,3-thiazol-2-yl)ethyl 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 87925339 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(3-amino-2H-1,3-thiazol-2-yl)ethyl 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)OCCC2SC=CN2N)c(C)c1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-10-8-11(2)14(12(3)9-10)21(17,18)19-6-4-13-16(15)5-7-20-13/h5,7-9,13H,4,6,15H2,1-3H3 |
| InChIKey | UDESIUDZBWYKIS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|