C17H15Cl4N3O2S — CID 87925420
1H-benzimidazole;2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 87925420) has the molecular formula C17H15Cl4N3O2S and a molecular weight of 467.21 g/mol. Its IUPAC name is 1H-benzimidazole;2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 1H-benzimidazole;2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 87925420 |
| Molecular Formula | C17H15Cl4N3O2S |
| Molecular Weight | 467.21 g/mol |
| Exact Mass | 464.96 |
| IUPAC Name | 1H-benzimidazole;2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1SC(Cl)(Cl)C(Cl)Cl.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C10H9Cl4NO2S.C7H6N2/c11-9(12)10(13,14)18-15-7(16)5-3-1-2-4-6(5)8(15)17;1-2-4-7-6(3-1)8-5-9-7/h1-2,5-6,9H,3-4H2;1-5H,(H,8,9) |
| InChIKey | CUGSSFSAAJRGRJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.21 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|