About 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one
9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one (PubChem CID 87925820) has the molecular formula C19H13BrN2O3
and a molecular weight of 397.23 g/mol. Its IUPAC name is 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one |
| PubChem CID | 87925820 |
| Molecular Formula | C19H13BrN2O3 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one |
| SMILES | CON1C(=O)Cc2c([nH]c3ccc(Br)cc23)-c2c(C=C=O)cccc21 |
| InChI | InChI=1S/C19H13BrN2O3/c1-25-22-16-4-2-3-11(7-8-23)18(16)19-14(10-17(22)24)13-9-12(20)5-6-15(13)21-19/h2-7,9,21H,10H2,1H3 |
| InChIKey | RHPNXYFWYPATNI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one?
The IUPAC name of 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one (CID 87925820) is 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one.
What is the SMILES notation for 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one?
The canonical SMILES for 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one is CON1C(=O)Cc2c([nH]c3ccc(Br)cc23)-c2c(C=C=O)cccc21.
What is the InChIKey of 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one?
The InChIKey is RHPNXYFWYPATNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrN2O3/c1-25-22-16-4-2-3-11(7-8-23)18(16)19-14(10-17(22)24)13-9-12(20)5-6-15(13)21-19/h2-7,9,21H,10H2,1H3.
What are the key properties of 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one?
9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one has a molecular weight of 397.23 g/mol, XLogP of 3.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-5-methoxy-1-(2-oxoethenyl)-7,12-dihydroindolo[3,2-d][1]benzazepin-6-one is sourced from PubChem (CID 87925820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).