About 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid
6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid (PubChem CID 87926224) has the molecular formula C10H17BFN3O2
and a molecular weight of 241.08 g/mol. Its IUPAC name is 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid.
Molecular Properties
| Compound Name | 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid |
| PubChem CID | 87926224 |
| Molecular Formula | C10H17BFN3O2 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid |
| SMILES | CCN(CC)C1C=CC=CC1=[N+]=[N-].OB(O)F |
| InChI | InChI=1S/C10H15N3.BFH2O2/c1-3-13(4-2)10-8-6-5-7-9(10)12-11;2-1(3)4/h5-8,10H,3-4H2,1-2H3;3-4H |
| InChIKey | XDNLYJWMUASFMG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid?
The IUPAC name of 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid (CID 87926224) is 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid.
What is the SMILES notation for 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid?
The canonical SMILES for 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid is CCN(CC)C1C=CC=CC1=[N+]=[N-].OB(O)F.
What is the InChIKey of 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid?
The InChIKey is XDNLYJWMUASFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3.BFH2O2/c1-3-13(4-2)10-8-6-5-7-9(10)12-11;2-1(3)4/h5-8,10H,3-4H2,1-2H3;3-4H.
What are the key properties of 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid?
6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid has a molecular weight of 241.08 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazo-N,N-diethylcyclohexa-2,4-dien-1-amine;fluoroboronic acid is sourced from PubChem (CID 87926224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).