C15H22N3O+ — CID 8792659
(4-cyanophenyl)methyl-ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium (PubChem CID 8792659) has the molecular formula C15H22N3O+ and a molecular weight of 260.36 g/mol. Its IUPAC name is (4-cyanophenyl)methyl-ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium.
| Compound Name | (4-cyanophenyl)methyl-ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8792659 |
| Molecular Formula | C15H22N3O+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (4-cyanophenyl)methyl-ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
| SMILES | CC[NH+](CC(=O)NC(C)C)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H21N3O/c1-4-18(11-15(19)17-12(2)3)10-14-7-5-13(9-16)6-8-14/h5-8,12H,4,10-11H2,1-3H3,(H,17,19)/p+1 |
| InChIKey | KWBJXQQOYMULNA-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |