C34H33F6N5O2 — CID 87926650
(2S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(pyridin-2-ylmethylamino)-2-[4-[(pyridin-2-ylmethylamino)methyl]benzoyl]pentanamide (PubChem CID 87926650) has the molecular formula C34H33F6N5O2 and a molecular weight of 657.66 g/mol. Its IUPAC name is (2S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(pyridin-2-ylmethylamino)-2-[4-[(pyridin-2-ylmethylamino)methyl]benzoyl]pentanamide.
| Compound Name | (2S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(pyridin-2-ylmethylamino)-2-[4-[(pyridin-2-ylmethylamino)methyl]benzoyl]pentanamide |
|---|---|
| PubChem CID | 87926650 |
| Molecular Formula | C34H33F6N5O2 |
| Molecular Weight | 657.66 g/mol |
| Exact Mass | 657.25 |
| IUPAC Name | (2S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(pyridin-2-ylmethylamino)-2-[4-[(pyridin-2-ylmethylamino)methyl]benzoyl]pentanamide |
| SMILES | O=C(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H](CCCNCc1ccccn1)C(=O)c1ccc(CNCc2ccccn2)cc1 |
| InChI | InChI=1S/C34H33F6N5O2/c35-33(36,37)26-16-24(17-27(18-26)34(38,39)40)20-45-32(47)30(8-5-13-41-21-28-6-1-3-14-43-28)31(46)25-11-9-23(10-12-25)19-42-22-29-7-2-4-15-44-29/h1-4,6-7,9-12,14-18,30,41-42H,5,8,13,19-22H2,(H,45,47)/t30-/m0/s1 |
| InChIKey | MJOHRQVIJCGTIW-PMERELPUSA-N |
| XLogP | 6.49 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|