About 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol
5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol (PubChem CID 87926653) has the molecular formula C14H30O2
and a molecular weight of 230.39 g/mol. Its IUPAC name is 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol |
| PubChem CID | 87926653 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol |
| SMILES | CCC(C)C(C)COCC(C)CC(C)CO |
| InChI | InChI=1S/C14H30O2/c1-6-13(4)14(5)10-16-9-12(3)7-11(2)8-15/h11-15H,6-10H2,1-5H3 |
| InChIKey | HGWSFBHRPTWABB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol?
The IUPAC name of 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol (CID 87926653) is 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol.
What is the SMILES notation for 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol?
The canonical SMILES for 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol is CCC(C)C(C)COCC(C)CC(C)CO.
What is the InChIKey of 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol?
The InChIKey is HGWSFBHRPTWABB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O2/c1-6-13(4)14(5)10-16-9-12(3)7-11(2)8-15/h11-15H,6-10H2,1-5H3.
What are the key properties of 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol?
5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol has a molecular weight of 230.39 g/mol, XLogP of 3.34, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dimethylpentoxy)-2,4-dimethylpentan-1-ol is sourced from PubChem (CID 87926653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).