About carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate
carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate (PubChem CID 87926671) has the molecular formula C25H23Cl2N3O4S
and a molecular weight of 532.45 g/mol. Its IUPAC name is carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate |
| PubChem CID | 87926671 |
| Molecular Formula | C25H23Cl2N3O4S |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate |
| SMILES | CCc1nc2cc(Cl)c(Cl)cc2n1-c1ccc(CCc2cc(C)ccc2S(=O)(=O)OC(N)=O)cc1 |
| InChI | InChI=1S/C25H23Cl2N3O4S/c1-3-24-29-21-13-19(26)20(27)14-22(21)30(24)18-9-6-16(7-10-18)5-8-17-12-15(2)4-11-23(17)35(32,33)34-25(28)31/h4,6-7,9-14H,3,5,8H2,1-2H3,(H2,28,31) |
| InChIKey | UUAGHKHMHDUAQH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate?
The IUPAC name of carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate (CID 87926671) is carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate.
What is the SMILES notation for carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate?
The canonical SMILES for carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate is CCc1nc2cc(Cl)c(Cl)cc2n1-c1ccc(CCc2cc(C)ccc2S(=O)(=O)OC(N)=O)cc1.
What is the InChIKey of carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate?
The InChIKey is UUAGHKHMHDUAQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23Cl2N3O4S/c1-3-24-29-21-13-19(26)20(27)14-22(21)30(24)18-9-6-16(7-10-18)5-8-17-12-15(2)4-11-23(17)35(32,33)34-25(28)31/h4,6-7,9-14H,3,5,8H2,1-2H3,(H2,28,31).
What are the key properties of carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate?
carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate has a molecular weight of 532.45 g/mol, XLogP of 5.77, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyl 2-[2-[4-(5,6-dichloro-2-ethylbenzimidazol-1-yl)phenyl]ethyl]-4-methylbenzenesulfonate is sourced from PubChem (CID 87926671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).