C34H39N5O3 — CID 87926713
(2S)-N-[2-(4-methoxyphenyl)ethyl]-5-(pyridin-2-ylmethylamino)-2-[4-[(pyridin-2-ylmethylamino)methyl]benzoyl]pentanamide (PubChem CID 87926713) has the molecular formula C34H39N5O3 and a molecular weight of 565.72 g/mol. Its IUPAC name is (2S)-N-[2-(4-methoxyphenyl)ethyl]-5-(pyridin-2-ylmethylamino)-2-[4-[(pyridin-2-ylmethylamino)methyl]benzoyl]pentanamide.
| Compound Name | (2S)-N-[2-(4-methoxyphenyl)ethyl]-5-(pyridin-2-ylmethylamino)-2-[4-[(pyridin-2-ylmethylamino)methyl]benzoyl]pentanamide |
|---|---|
| PubChem CID | 87926713 |
| Molecular Formula | C34H39N5O3 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | (2S)-N-[2-(4-methoxyphenyl)ethyl]-5-(pyridin-2-ylmethylamino)-2-[4-[(pyridin-2-ylmethylamino)methyl]benzoyl]pentanamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H](CCCNCc2ccccn2)C(=O)c2ccc(CNCc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C34H39N5O3/c1-42-31-16-12-26(13-17-31)18-22-39-34(41)32(9-6-19-35-24-29-7-2-4-20-37-29)33(40)28-14-10-27(11-15-28)23-36-25-30-8-3-5-21-38-30/h2-5,7-8,10-17,20-21,32,35-36H,6,9,18-19,22-25H2,1H3,(H,39,41)/t32-/m0/s1 |
| InChIKey | LYNYJCDVSKKNOQ-YTTGMZPUSA-N |
| XLogP | 4.50 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|