C16H18N2OS — CID 87927695
3-(1-benzothiophen-3-yl)-N-cyano-N-ethyl-2,2-dimethylpropanamide (PubChem CID 87927695) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-N-cyano-N-ethyl-2,2-dimethylpropanamide.
| Compound Name | 3-(1-benzothiophen-3-yl)-N-cyano-N-ethyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 87927695 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-N-cyano-N-ethyl-2,2-dimethylpropanamide |
| SMILES | CCN(C#N)C(=O)C(C)(C)Cc1csc2ccccc12 |
| InChI | InChI=1S/C16H18N2OS/c1-4-18(11-17)15(19)16(2,3)9-12-10-20-14-8-6-5-7-13(12)14/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | KZGWKXXOJYDTNE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|