C14H25N3O3S — CID 87927863
hexyl N-[1-(1-cyanoethylamino)-3-methylsulfanyl-1-oxopropan-2-yl]carbamate (PubChem CID 87927863) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is hexyl N-[1-(1-cyanoethylamino)-3-methylsulfanyl-1-oxopropan-2-yl]carbamate.
| Compound Name | hexyl N-[1-(1-cyanoethylamino)-3-methylsulfanyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87927863 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | hexyl N-[1-(1-cyanoethylamino)-3-methylsulfanyl-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCOC(=O)NC(CSC)C(=O)NC(C)C#N |
| InChI | InChI=1S/C14H25N3O3S/c1-4-5-6-7-8-20-14(19)17-12(10-21-3)13(18)16-11(2)9-15/h11-12H,4-8,10H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | XRVZXMWZXYJHHH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|