About (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate
(3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate (PubChem CID 87928102) has the molecular formula C13H11F3N2O5S
and a molecular weight of 364.30 g/mol. Its IUPAC name is (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate.
Molecular Properties
| Compound Name | (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate |
| PubChem CID | 87928102 |
| Molecular Formula | C13H11F3N2O5S |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate |
| SMILES | NC(=O)CCOS(=O)(=O)c1ccc2[nH]c(=O)cc(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C13H11F3N2O5S/c14-13(15,16)9-6-12(20)18-10-2-1-7(5-8(9)10)24(21,22)23-4-3-11(17)19/h1-2,5-6H,3-4H2,(H2,17,19)(H,18,20) |
| InChIKey | RYLOBDPCHXKFAZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate?
The IUPAC name of (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate (CID 87928102) is (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate.
What is the SMILES notation for (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate?
The canonical SMILES for (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate is NC(=O)CCOS(=O)(=O)c1ccc2[nH]c(=O)cc(C(F)(F)F)c2c1.
What is the InChIKey of (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate?
The InChIKey is RYLOBDPCHXKFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O5S/c14-13(15,16)9-6-12(20)18-10-2-1-7(5-8(9)10)24(21,22)23-4-3-11(17)19/h1-2,5-6H,3-4H2,(H2,17,19)(H,18,20).
What are the key properties of (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate?
(3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate has a molecular weight of 364.30 g/mol, XLogP of 1.13, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-3-oxopropyl) 2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonate is sourced from PubChem (CID 87928102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).