C19H26N4O — CID 87928133
N-methoxy-2-[2-methyl-7-(2,4,6-trimethylphenyl)-5,6-dihydro-4H-pyrazolo[3,4-b]pyridin-3-yl]ethanimine (PubChem CID 87928133) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is N-methoxy-2-[2-methyl-7-(2,4,6-trimethylphenyl)-5,6-dihydro-4H-pyrazolo[3,4-b]pyridin-3-yl]ethanimine.
| Compound Name | N-methoxy-2-[2-methyl-7-(2,4,6-trimethylphenyl)-5,6-dihydro-4H-pyrazolo[3,4-b]pyridin-3-yl]ethanimine |
|---|---|
| PubChem CID | 87928133 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-methoxy-2-[2-methyl-7-(2,4,6-trimethylphenyl)-5,6-dihydro-4H-pyrazolo[3,4-b]pyridin-3-yl]ethanimine |
| SMILES | CON=CCc1c2c(nn1C)N(c1c(C)cc(C)cc1C)CCC2 |
| InChI | InChI=1S/C19H26N4O/c1-13-11-14(2)18(15(3)12-13)23-10-6-7-16-17(8-9-20-24-5)22(4)21-19(16)23/h9,11-12H,6-8,10H2,1-5H3 |
| InChIKey | VZGQZAYIIBXOEH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|