C17H12AsClN6 — CID 87928146
CID 87928146 (PubChem CID 87928146) has the molecular formula C17H12AsClN6 and a molecular weight of 410.70 g/mol.
| Compound Name | CID 87928146 |
|---|---|
| PubChem CID | 87928146 |
| Molecular Formula | C17H12AsClN6 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | — |
| SMILES | Cc1cccc(Cl)c1Nc1nc([As])nc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C17H12AsClN6/c1-10-3-2-4-13(19)14(10)22-17-24-15(18)23-16(25-17)21-12-7-5-11(9-20)6-8-12/h2-8H,1H3,(H2,21,22,23,24,25) |
| InChIKey | UJINYCWZXFDEPY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|