About 2-methylbutanoylcarbamic acid
2-methylbutanoylcarbamic acid (PubChem CID 87928192) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-methylbutanoylcarbamic acid.
Molecular Properties
| Compound Name | 2-methylbutanoylcarbamic acid |
| PubChem CID | 87928192 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-methylbutanoylcarbamic acid |
| SMILES | CCC(C)C(=O)NC(=O)O |
| InChI | InChI=1S/C6H11NO3/c1-3-4(2)5(8)7-6(9)10/h4H,3H2,1-2H3,(H,7,8)(H,9,10) |
| InChIKey | MMNKUGHVJNGULM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylbutanoylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutanoylcarbamic acid?
The IUPAC name of 2-methylbutanoylcarbamic acid (CID 87928192) is 2-methylbutanoylcarbamic acid.
What is the SMILES notation for 2-methylbutanoylcarbamic acid?
The canonical SMILES for 2-methylbutanoylcarbamic acid is CCC(C)C(=O)NC(=O)O.
What is the InChIKey of 2-methylbutanoylcarbamic acid?
The InChIKey is MMNKUGHVJNGULM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-3-4(2)5(8)7-6(9)10/h4H,3H2,1-2H3,(H,7,8)(H,9,10).
What are the key properties of 2-methylbutanoylcarbamic acid?
2-methylbutanoylcarbamic acid has a molecular weight of 145.16 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutanoylcarbamic acid is sourced from PubChem (CID 87928192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).