C12H22O12 — CID 87928323
(3S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexan-1-one;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 87928323) has the molecular formula C12H22O12 and a molecular weight of 358.30 g/mol. Its IUPAC name is (3S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexan-1-one;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | (3S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexan-1-one;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 87928323 |
| Molecular Formula | C12H22O12 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (3S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexan-1-one;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=C1C(O)[C@@H](O)C(O)[C@H](O)[C@H]1O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H10O6.C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9;7-1-3(9)5(11)6(12)4(10)2-8/h1-5,7-11H;1,3-6,8-12H,2H2/t1?,2-,3-,4+,5?;3-,4+,5+,6+/m00/s1 |
| InChIKey | VKGVOEZUAVNLAP-XRWRWMDMSA-N |
| XLogP | -7.01 |
| TPSA | 236.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | -7.01 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|