About 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea
1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea (PubChem CID 87928408) has the molecular formula C19H18FN3OS
and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea.
Molecular Properties
| Compound Name | 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea |
| PubChem CID | 87928408 |
| Molecular Formula | C19H18FN3OS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea |
| SMILES | CC1(C)C[C@H](N(C(N)=S)c2ccc(C#N)cc2)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C19H18FN3OS/c1-19(2)10-16(15-9-13(20)5-8-17(15)24-19)23(18(22)25)14-6-3-12(11-21)4-7-14/h3-9,16H,10H2,1-2H3,(H2,22,25)/t16-/m0/s1 |
| InChIKey | PUQRIKREULXTTG-INIZCTEOSA-N |
| XLogP | 4.05 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea?
The IUPAC name of 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea (CID 87928408) is 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea.
What is the SMILES notation for 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea?
The canonical SMILES for 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea is CC1(C)C[C@H](N(C(N)=S)c2ccc(C#N)cc2)c2cc(F)ccc2O1.
What is the InChIKey of 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea?
The InChIKey is PUQRIKREULXTTG-INIZCTEOSA-N. The full InChI is InChI=1S/C19H18FN3OS/c1-19(2)10-16(15-9-13(20)5-8-17(15)24-19)23(18(22)25)14-6-3-12(11-21)4-7-14/h3-9,16H,10H2,1-2H3,(H2,22,25)/t16-/m0/s1.
What are the key properties of 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea?
1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea has a molecular weight of 355.44 g/mol, XLogP of 4.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyanophenyl)-1-[(4S)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea is sourced from PubChem (CID 87928408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).