C25H27F2N3O4 — CID 87928577
(2S,3S,5S)-5-(3,5-difluorophenoxy)-N-hydroxy-N-methyl-2-(4-phenyl-1,2,3,6-tetrahydropyridine-2-carbonyl)piperidine-3-carboxamide (PubChem CID 87928577) has the molecular formula C25H27F2N3O4 and a molecular weight of 471.50 g/mol. Its IUPAC name is (2S,3S,5S)-5-(3,5-difluorophenoxy)-N-hydroxy-N-methyl-2-(4-phenyl-1,2,3,6-tetrahydropyridine-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | (2S,3S,5S)-5-(3,5-difluorophenoxy)-N-hydroxy-N-methyl-2-(4-phenyl-1,2,3,6-tetrahydropyridine-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87928577 |
| Molecular Formula | C25H27F2N3O4 |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (2S,3S,5S)-5-(3,5-difluorophenoxy)-N-hydroxy-N-methyl-2-(4-phenyl-1,2,3,6-tetrahydropyridine-2-carbonyl)piperidine-3-carboxamide |
| SMILES | CN(O)C(=O)[C@H]1C[C@H](Oc2cc(F)cc(F)c2)CN[C@@H]1C(=O)C1CC(c2ccccc2)=CCN1 |
| InChI | InChI=1S/C25H27F2N3O4/c1-30(33)25(32)21-13-20(34-19-11-17(26)10-18(27)12-19)14-29-23(21)24(31)22-9-16(7-8-28-22)15-5-3-2-4-6-15/h2-7,10-12,20-23,28-29,33H,8-9,13-14H2,1H3/t20-,21-,22?,23-/m0/s1 |
| InChIKey | CJRIVZPEZDEFLG-WUTAMTCCSA-N |
| XLogP | 2.55 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|