About bis(2-carboxyquinolin-8-olate);europium(2+)
bis(2-carboxyquinolin-8-olate);europium(2+) (PubChem CID 87928997) has the molecular formula C20H12EuN2O6
and a molecular weight of 528.29 g/mol. Its IUPAC name is bis(2-carboxyquinolin-8-olate);europium(2+).
Molecular Properties
| Compound Name | bis(2-carboxyquinolin-8-olate);europium(2+) |
| PubChem CID | 87928997 |
| Molecular Formula | C20H12EuN2O6 |
| Molecular Weight | 528.29 g/mol |
| Exact Mass | 528.99 |
| IUPAC Name | bis(2-carboxyquinolin-8-olate);europium(2+) |
| SMILES | O=C(O)c1ccc2cccc([O-])c2n1.O=C(O)c1ccc2cccc([O-])c2n1.[Eu+2] |
| InChI | InChI=1S/2C10H7NO3.Eu/c2*12-8-3-1-2-6-4-5-7(10(13)14)11-9(6)8;/h2*1-5,12H,(H,13,14);/q;;+2/p-2 |
| InChIKey | BJWIHKGNQYWROB-UHFFFAOYSA-L |
| XLogP | 2.01 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-carboxyquinolin-8-olate);europium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-carboxyquinolin-8-olate);europium(2+)?
The IUPAC name of bis(2-carboxyquinolin-8-olate);europium(2+) (CID 87928997) is bis(2-carboxyquinolin-8-olate);europium(2+).
What is the SMILES notation for bis(2-carboxyquinolin-8-olate);europium(2+)?
The canonical SMILES for bis(2-carboxyquinolin-8-olate);europium(2+) is O=C(O)c1ccc2cccc([O-])c2n1.O=C(O)c1ccc2cccc([O-])c2n1.[Eu+2].
What is the InChIKey of bis(2-carboxyquinolin-8-olate);europium(2+)?
The InChIKey is BJWIHKGNQYWROB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H7NO3.Eu/c2*12-8-3-1-2-6-4-5-7(10(13)14)11-9(6)8;/h2*1-5,12H,(H,13,14);/q;;+2/p-2.
What are the key properties of bis(2-carboxyquinolin-8-olate);europium(2+)?
bis(2-carboxyquinolin-8-olate);europium(2+) has a molecular weight of 528.29 g/mol, XLogP of 2.01, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-carboxyquinolin-8-olate);europium(2+) is sourced from PubChem (CID 87928997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).