C5H6F4N2O2 — CID 87929309
N-(2-amino-2-oxoethyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 87929309) has the molecular formula C5H6F4N2O2 and a molecular weight of 202.11 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 87929309 |
| Molecular Formula | C5H6F4N2O2 |
| Molecular Weight | 202.11 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | NC(=O)CNC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C5H6F4N2O2/c6-3(7)5(8,9)4(13)11-1-2(10)12/h3H,1H2,(H2,10,12)(H,11,13) |
| InChIKey | GEZZEZYNFJBISQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.11 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|