About 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane
1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane (PubChem CID 87929357) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane |
| PubChem CID | 87929357 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane |
| SMILES | O=C=NCCC12CCC(C1)C1CCCC12CCN=C=O |
| InChI | InChI=1S/C16H22N2O2/c19-11-17-8-6-15-5-3-13(10-15)14-2-1-4-16(14,15)7-9-18-12-20/h13-14H,1-10H2 |
| InChIKey | JWINBRXVKXHUOC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane?
The IUPAC name of 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane (CID 87929357) is 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane?
The canonical SMILES for 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane is O=C=NCCC12CCC(C1)C1CCCC12CCN=C=O.
What is the InChIKey of 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane?
The InChIKey is JWINBRXVKXHUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c19-11-17-8-6-15-5-3-13(10-15)14-2-1-4-16(14,15)7-9-18-12-20/h13-14H,1-10H2.
What are the key properties of 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane?
1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane has a molecular weight of 274.36 g/mol, XLogP of 3.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(2-isocyanatoethyl)tricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 87929357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).