C18H16F12N2O7 — CID 87930082
bis(4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-oxazol-5-one);(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 87930082) has the molecular formula C18H16F12N2O7 and a molecular weight of 600.31 g/mol. Its IUPAC name is bis(4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-oxazol-5-one);(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | bis(4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-oxazol-5-one);(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87930082 |
| Molecular Formula | C18H16F12N2O7 |
| Molecular Weight | 600.31 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | bis(4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-oxazol-5-one);(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | CC(C)C1=NC(C(F)(F)F)OC1=O.CC(C)C1=NC(C(F)(F)F)OC1=O.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C7H8F3NO2.C4F6O3/c2*1-3(2)4-5(12)13-6(11-4)7(8,9)10;5-3(6,7)1(11)13-2(12)4(8,9)10/h2*3,6H,1-2H3; |
| InChIKey | HAUFTQVHFCCMSP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|