C24H27FN4O3S — CID 87930818
2-[(4-fluorophenyl)methoxy]-N-[5-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]acetamide (PubChem CID 87930818) has the molecular formula C24H27FN4O3S and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methoxy]-N-[5-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methoxy]-N-[5-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 87930818 |
| Molecular Formula | C24H27FN4O3S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-[(4-fluorophenyl)methoxy]-N-[5-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]acetamide |
| SMILES | O=C(COCc1ccc(F)cc1)NCCCCCc1csc(NC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C24H27FN4O3S/c25-19-12-10-18(11-13-19)15-32-16-22(30)26-14-6-2-5-9-21-17-33-24(28-21)29-23(31)27-20-7-3-1-4-8-20/h1,3-4,7-8,10-13,17H,2,5-6,9,14-16H2,(H,26,30)(H2,27,28,29,31) |
| InChIKey | BIXGLBSNONRZNC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|