C24F18S — CID 87931007
1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]sulfanylphenyl]benzene (PubChem CID 87931007) has the molecular formula C24F18S and a molecular weight of 662.29 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]sulfanylphenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]sulfanylphenyl]benzene |
|---|---|
| PubChem CID | 87931007 |
| Molecular Formula | C24F18S |
| Molecular Weight | 662.29 g/mol |
| Exact Mass | 661.94 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]sulfanylphenyl]benzene |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(Sc3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24F18S/c25-5-1(6(26)14(34)17(37)13(5)33)3-9(29)19(39)23(20(40)10(3)30)43-24-21(41)11(31)4(12(32)22(24)42)2-7(27)15(35)18(38)16(36)8(2)28 |
| InChIKey | KPBDRYDJYVLJBR-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.29 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|