About 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine
1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine (PubChem CID 87931272) has the molecular formula C8H22N8P2S2
and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine.
Molecular Properties
| Compound Name | 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine |
| PubChem CID | 87931272 |
| Molecular Formula | C8H22N8P2S2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine |
| SMILES | NP(N)(=S)N1C=CC=NC1.NP(N)(=S)N1CCNCC1 |
| InChI | InChI=1S/C4H13N4PS.C4H9N4PS/c5-9(6,10)8-3-1-7-2-4-8;5-9(6,10)8-3-1-2-7-4-8/h7H,1-4H2,(H4,5,6,10);1-3H,4H2,(H4,5,6,10) |
| InChIKey | IDRZGBQTGRNUSF-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine?
The IUPAC name of 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine (CID 87931272) is 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine.
What is the SMILES notation for 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine?
The canonical SMILES for 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine is NP(N)(=S)N1C=CC=NC1.NP(N)(=S)N1CCNCC1.
What is the InChIKey of 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine?
The InChIKey is IDRZGBQTGRNUSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13N4PS.C4H9N4PS/c5-9(6,10)8-3-1-7-2-4-8;5-9(6,10)8-3-1-2-7-4-8/h7H,1-4H2,(H4,5,6,10);1-3H,4H2,(H4,5,6,10).
What are the key properties of 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine?
1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine has a molecular weight of 356.40 g/mol, XLogP of -0.98, 2 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diaminophosphinothioylpiperazine;1-diaminophosphinothioyl-2H-pyrimidine is sourced from PubChem (CID 87931272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).