About 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid
2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid (PubChem CID 87931343) has the molecular formula C7H14O5S
and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid.
Molecular Properties
| Compound Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid |
| PubChem CID | 87931343 |
| Molecular Formula | C7H14O5S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid |
| SMILES | CC1(C)OC[C@H](CCS(=O)(=O)O)O1 |
| InChI | InChI=1S/C7H14O5S/c1-7(2)11-5-6(12-7)3-4-13(8,9)10/h6H,3-5H2,1-2H3,(H,8,9,10)/t6-/m0/s1 |
| InChIKey | WBYXIUGMNKWTAD-LURJTMIESA-N |
| XLogP | 0.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid?
The IUPAC name of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid (CID 87931343) is 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid.
What is the SMILES notation for 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid?
The canonical SMILES for 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid is CC1(C)OC[C@H](CCS(=O)(=O)O)O1.
What is the InChIKey of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid?
The InChIKey is WBYXIUGMNKWTAD-LURJTMIESA-N. The full InChI is InChI=1S/C7H14O5S/c1-7(2)11-5-6(12-7)3-4-13(8,9)10/h6H,3-5H2,1-2H3,(H,8,9,10)/t6-/m0/s1.
What are the key properties of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid?
2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid has a molecular weight of 210.25 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanesulfonic acid is sourced from PubChem (CID 87931343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).