C30H50F3N3O6 — CID 87931358
5-amino-N-butyl-4-hydroxy-7-[[2-[2-(methoxymethoxy)ethoxy]-N-(2,2,2-trifluoroacetyl)anilino]methyl]-8-methyl-2-propan-2-ylnonanamide (PubChem CID 87931358) has the molecular formula C30H50F3N3O6 and a molecular weight of 605.74 g/mol. Its IUPAC name is 5-amino-N-butyl-4-hydroxy-7-[[2-[2-(methoxymethoxy)ethoxy]-N-(2,2,2-trifluoroacetyl)anilino]methyl]-8-methyl-2-propan-2-ylnonanamide.
| Compound Name | 5-amino-N-butyl-4-hydroxy-7-[[2-[2-(methoxymethoxy)ethoxy]-N-(2,2,2-trifluoroacetyl)anilino]methyl]-8-methyl-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 87931358 |
| Molecular Formula | C30H50F3N3O6 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.37 |
| IUPAC Name | 5-amino-N-butyl-4-hydroxy-7-[[2-[2-(methoxymethoxy)ethoxy]-N-(2,2,2-trifluoroacetyl)anilino]methyl]-8-methyl-2-propan-2-ylnonanamide |
| SMILES | CCCCNC(=O)C(CC(O)C(N)CC(CN(C(=O)C(F)(F)F)c1ccccc1OCCOCOC)C(C)C)C(C)C |
| InChI | InChI=1S/C30H50F3N3O6/c1-7-8-13-35-28(38)23(21(4)5)17-26(37)24(34)16-22(20(2)3)18-36(29(39)30(31,32)33)25-11-9-10-12-27(25)42-15-14-41-19-40-6/h9-12,20-24,26,37H,7-8,13-19,34H2,1-6H3,(H,35,38) |
| InChIKey | OBTUYIJAEPPDTG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|