About (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane
(2S)-1,4-dibromo-2-(ethylperoxymethyl)butane (PubChem CID 87931785) has the molecular formula C7H14Br2O2
and a molecular weight of 290.00 g/mol. Its IUPAC name is (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane.
Molecular Properties
| Compound Name | (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane |
| PubChem CID | 87931785 |
| Molecular Formula | C7H14Br2O2 |
| Molecular Weight | 290.00 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane |
| SMILES | CCOOC[C@@H](CBr)CCBr |
| InChI | InChI=1S/C7H14Br2O2/c1-2-10-11-6-7(5-9)3-4-8/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | NACMCLSHBNUNNY-SSDOTTSWSA-N |
| XLogP | 2.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.00 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane?
The IUPAC name of (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane (CID 87931785) is (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane.
What is the SMILES notation for (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane?
The canonical SMILES for (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane is CCOOC[C@@H](CBr)CCBr.
What is the InChIKey of (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane?
The InChIKey is NACMCLSHBNUNNY-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H14Br2O2/c1-2-10-11-6-7(5-9)3-4-8/h7H,2-6H2,1H3/t7-/m1/s1.
What are the key properties of (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane?
(2S)-1,4-dibromo-2-(ethylperoxymethyl)butane has a molecular weight of 290.00 g/mol, XLogP of 2.75, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,4-dibromo-2-(ethylperoxymethyl)butane is sourced from PubChem (CID 87931785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).