C25H17BrF4N6O4 — CID 87931851
[[C-[4-(N-[4-(aminomethyl)benzoyl]anilino)-1,2,5-oxadiazol-3-yl]-N-(3-bromo-4-fluorophenyl)carbonimidoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 87931851) has the molecular formula C25H17BrF4N6O4 and a molecular weight of 621.35 g/mol. Its IUPAC name is [[C-[4-(N-[4-(aminomethyl)benzoyl]anilino)-1,2,5-oxadiazol-3-yl]-N-(3-bromo-4-fluorophenyl)carbonimidoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[C-[4-(N-[4-(aminomethyl)benzoyl]anilino)-1,2,5-oxadiazol-3-yl]-N-(3-bromo-4-fluorophenyl)carbonimidoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87931851 |
| Molecular Formula | C25H17BrF4N6O4 |
| Molecular Weight | 621.35 g/mol |
| Exact Mass | 620.04 |
| IUPAC Name | [[C-[4-(N-[4-(aminomethyl)benzoyl]anilino)-1,2,5-oxadiazol-3-yl]-N-(3-bromo-4-fluorophenyl)carbonimidoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | NCc1ccc(C(=O)N(c2ccccc2)c2nonc2/C(=N/c2ccc(F)c(Br)c2)NOC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H17BrF4N6O4/c26-18-12-16(10-11-19(18)27)32-21(34-39-24(38)25(28,29)30)20-22(35-40-33-20)36(17-4-2-1-3-5-17)23(37)15-8-6-14(13-31)7-9-15/h1-12H,13,31H2,(H,32,34) |
| InChIKey | CWJHMGRHRUWVBV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|