C88H60FeN8 — CID 87932024
iron;bis(10,12,13,23-tetraphenyl-21H-porphyrin) (PubChem CID 87932024) has the molecular formula C88H60FeN8 and a molecular weight of 1285.35 g/mol. Its IUPAC name is iron;bis(10,12,13,23-tetraphenyl-21H-porphyrin).
| Compound Name | iron;bis(10,12,13,23-tetraphenyl-21H-porphyrin) |
|---|---|
| PubChem CID | 87932024 |
| Molecular Formula | C88H60FeN8 |
| Molecular Weight | 1285.35 g/mol |
| Exact Mass | 1284.43 |
| IUPAC Name | iron;bis(10,12,13,23-tetraphenyl-21H-porphyrin) |
| SMILES | C1=Cc2cc3c(-c4ccccc4)c(-c4ccccc4)c(c(-c4ccccc4)c4nc(cc5ccc(cc1n2)[nH]5)C=C4)n3-c1ccccc1.C1=Cc2cc3c(-c4ccccc4)c(-c4ccccc4)c(c(-c4ccccc4)c4nc(cc5ccc(cc1n2)[nH]5)C=C4)n3-c1ccccc1.[Fe] |
| InChI | InChI=1S/2C44H30N4.Fe/c2*1-5-13-30(14-6-1)41-39-26-25-36(47-39)28-35-22-21-33(45-35)27-34-23-24-37(46-34)29-40-42(31-15-7-2-8-16-31)43(32-17-9-3-10-18-32)44(41)48(40)38-19-11-4-12-20-38;/h2*1-29,45H;/b2*33-27-,34-27-,35-28-,36-28-,37-29-,40-29-,41-39-,44-41-; |
| InChIKey | MZRJYZLRAZFWDL-CMOBWCOOSA-N |
| XLogP | 22.24 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 97 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1285.35 |
| LogP ≤ 5 | 22.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|