C9H5F13 — CID 87932029
1,1,2,3,3,5,5,6,6,7,7,7-dodecafluoro-4-(fluoromethyl)-4-methylhept-1-ene (PubChem CID 87932029) has the molecular formula C9H5F13 and a molecular weight of 360.11 g/mol. Its IUPAC name is 1,1,2,3,3,5,5,6,6,7,7,7-dodecafluoro-4-(fluoromethyl)-4-methylhept-1-ene.
| Compound Name | 1,1,2,3,3,5,5,6,6,7,7,7-dodecafluoro-4-(fluoromethyl)-4-methylhept-1-ene |
|---|---|
| PubChem CID | 87932029 |
| Molecular Formula | C9H5F13 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 1,1,2,3,3,5,5,6,6,7,7,7-dodecafluoro-4-(fluoromethyl)-4-methylhept-1-ene |
| SMILES | CC(CF)(C(F)(F)C(F)=C(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F13/c1-5(2-10,6(14,15)3(11)4(12)13)7(16,17)8(18,19)9(20,21)22/h2H2,1H3 |
| InChIKey | GIMURPHPXHJXGF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|