C13H19NO7 — CID 87932085
2,3-dihydroxybutanedioic acid;(3R)-3-ethynyl-1-azabicyclo[2.2.2]octan-3-ol (PubChem CID 87932085) has the molecular formula C13H19NO7 and a molecular weight of 301.29 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;(3R)-3-ethynyl-1-azabicyclo[2.2.2]octan-3-ol.
| Compound Name | 2,3-dihydroxybutanedioic acid;(3R)-3-ethynyl-1-azabicyclo[2.2.2]octan-3-ol |
|---|---|
| PubChem CID | 87932085 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;(3R)-3-ethynyl-1-azabicyclo[2.2.2]octan-3-ol |
| SMILES | C#C[C@@]1(O)CN2CCC1CC2.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C9H13NO.C4H6O6/c1-2-9(11)7-10-5-3-8(9)4-6-10;5-1(3(7)8)2(6)4(9)10/h1,8,11H,3-7H2;1-2,5-6H,(H,7,8)(H,9,10)/t9-;/m1./s1 |
| InChIKey | WGUKWKJCWRPHOU-SBSPUUFOSA-N |
| XLogP | -2.05 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|