C27H20AsF2N2O4 — CID 87932328
CID 87932328 (PubChem CID 87932328) has the molecular formula C27H20AsF2N2O4 and a molecular weight of 549.39 g/mol.
| Compound Name | CID 87932328 |
|---|---|
| PubChem CID | 87932328 |
| Molecular Formula | C27H20AsF2N2O4 |
| Molecular Weight | 549.39 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | — |
| SMILES | O=C([As]Cc1ccc(CNC(=O)c2cccnc2Oc2ccc(F)cc2)cc1)c1cc(F)ccc1O |
| InChI | InChI=1S/C27H20AsF2N2O4/c29-19-7-10-21(11-8-19)36-27-22(2-1-13-31-27)26(35)32-16-18-5-3-17(4-6-18)15-28-25(34)23-14-20(30)9-12-24(23)33/h1-14,33H,15-16H2,(H,32,35) |
| InChIKey | AZTAZIVXEGQESY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|