C30H55ClN6 — CID 87932442
N-butyl-1-[6-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]-2-chloropyrimidin-4-yl]-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 87932442) has the molecular formula C30H55ClN6 and a molecular weight of 535.27 g/mol. Its IUPAC name is N-butyl-1-[6-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]-2-chloropyrimidin-4-yl]-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-butyl-1-[6-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]-2-chloropyrimidin-4-yl]-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 87932442 |
| Molecular Formula | C30H55ClN6 |
| Molecular Weight | 535.27 g/mol |
| Exact Mass | 534.42 |
| IUPAC Name | N-butyl-1-[6-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]-2-chloropyrimidin-4-yl]-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CCCCNC1CC(C)(C)N(c2cc(N3C(C)(C)CC(NCCCC)CC3(C)C)nc(Cl)n2)C(C)(C)C1 |
| InChI | InChI=1S/C30H55ClN6/c1-11-13-15-32-22-18-27(3,4)36(28(5,6)19-22)24-17-25(35-26(31)34-24)37-29(7,8)20-23(21-30(37,9)10)33-16-14-12-2/h17,22-23,32-33H,11-16,18-21H2,1-10H3 |
| InChIKey | WLJKKNCJQPWNTM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.27 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|