About prop-2-enyltellanylurea
prop-2-enyltellanylurea (PubChem CID 87932709) has the molecular formula C4H8N2OTe
and a molecular weight of 227.72 g/mol. Its IUPAC name is prop-2-enyltellanylurea.
Molecular Properties
| Compound Name | prop-2-enyltellanylurea |
| PubChem CID | 87932709 |
| Molecular Formula | C4H8N2OTe |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | prop-2-enyltellanylurea |
| SMILES | C=CC[Te]NC(N)=O |
| InChI | InChI=1S/C4H8N2OTe/c1-2-3-8-6-4(5)7/h2H,1,3H2,(H3,5,6,7) |
| InChIKey | FNKLKUIHUBENDN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyltellanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyltellanylurea?
The IUPAC name of prop-2-enyltellanylurea (CID 87932709) is prop-2-enyltellanylurea.
What is the SMILES notation for prop-2-enyltellanylurea?
The canonical SMILES for prop-2-enyltellanylurea is C=CC[Te]NC(N)=O.
What is the InChIKey of prop-2-enyltellanylurea?
The InChIKey is FNKLKUIHUBENDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2OTe/c1-2-3-8-6-4(5)7/h2H,1,3H2,(H3,5,6,7).
What are the key properties of prop-2-enyltellanylurea?
prop-2-enyltellanylurea has a molecular weight of 227.72 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyltellanylurea is sourced from PubChem (CID 87932709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).