C5BrF9O — CID 87932724
1-bromo-1,1,3,3,4,4,5,5,5-nonafluoropentan-2-one (PubChem CID 87932724) has the molecular formula C5BrF9O and a molecular weight of 326.94 g/mol. Its IUPAC name is 1-bromo-1,1,3,3,4,4,5,5,5-nonafluoropentan-2-one.
| Compound Name | 1-bromo-1,1,3,3,4,4,5,5,5-nonafluoropentan-2-one |
|---|---|
| PubChem CID | 87932724 |
| Molecular Formula | C5BrF9O |
| Molecular Weight | 326.94 g/mol |
| Exact Mass | 325.90 |
| IUPAC Name | 1-bromo-1,1,3,3,4,4,5,5,5-nonafluoropentan-2-one |
| SMILES | O=C(C(F)(F)Br)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5BrF9O/c6-3(9,10)1(16)2(7,8)4(11,12)5(13,14)15 |
| InChIKey | XREQOJLCBFQUKJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.94 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|