C42H30F6N4O4S2 — CID 87932750
2,2-bis[6-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]indol-1-yl]acetic acid (PubChem CID 87932750) has the molecular formula C42H30F6N4O4S2 and a molecular weight of 832.85 g/mol. Its IUPAC name is 2,2-bis[6-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]indol-1-yl]acetic acid.
| Compound Name | 2,2-bis[6-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 87932750 |
| Molecular Formula | C42H30F6N4O4S2 |
| Molecular Weight | 832.85 g/mol |
| Exact Mass | 832.16 |
| IUPAC Name | 2,2-bis[6-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methoxy]indol-1-yl]acetic acid |
| SMILES | Cc1sc(-c2ccc(C(F)(F)F)cc2)nc1COc1ccc2ccn(C(C(=O)O)n3ccc4ccc(OCc5nc(-c6ccc(C(F)(F)F)cc6)sc5C)cc43)c2c1 |
| InChI | InChI=1S/C42H30F6N4O4S2/c1-23-33(49-37(57-23)27-3-9-29(10-4-27)41(43,44)45)21-55-31-13-7-25-15-17-51(35(25)19-31)39(40(53)54)52-18-16-26-8-14-32(20-36(26)52)56-22-34-24(2)58-38(50-34)28-5-11-30(12-6-28)42(46,47)48/h3-20,39H,21-22H2,1-2H3,(H,53,54) |
| InChIKey | WPZOIHPPBTYXTM-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.85 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |