C27H42N2O5 — CID 87933024
(3S)-3-[[(2S)-2-[[2-[(2,5-ditert-butylphenyl)methyl]oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid (PubChem CID 87933024) has the molecular formula C27H42N2O5 and a molecular weight of 474.64 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[2-[(2,5-ditert-butylphenyl)methyl]oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[2-[(2,5-ditert-butylphenyl)methyl]oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87933024 |
| Molecular Formula | C27H42N2O5 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[2-[(2,5-ditert-butylphenyl)methyl]oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](NC1(Cc2cc(C(C)(C)C)ccc2C(C)(C)C)CCCCO1)C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C27H42N2O5/c1-18(24(33)28-21(17-30)15-23(31)32)29-27(12-8-9-13-34-27)16-19-14-20(25(2,3)4)10-11-22(19)26(5,6)7/h10-11,14,17-18,21,29H,8-9,12-13,15-16H2,1-7H3,(H,28,33)(H,31,32)/t18-,21-,27?/m0/s1 |
| InChIKey | SOIKNBBYPPHJOA-HGGUUOBUSA-N |
| XLogP | 3.86 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|