C13H10F6N2O2 — CID 87933079
(1-cyanato-1,2,2,3,3,3-hexafluoropropyl) cyanate;ethylbenzene (PubChem CID 87933079) has the molecular formula C13H10F6N2O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is (1-cyanato-1,2,2,3,3,3-hexafluoropropyl) cyanate;ethylbenzene.
| Compound Name | (1-cyanato-1,2,2,3,3,3-hexafluoropropyl) cyanate;ethylbenzene |
|---|---|
| PubChem CID | 87933079 |
| Molecular Formula | C13H10F6N2O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (1-cyanato-1,2,2,3,3,3-hexafluoropropyl) cyanate;ethylbenzene |
| SMILES | CCc1ccccc1.N#COC(F)(OC#N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10.C5F6N2O2/c1-2-8-6-4-3-5-7-8;6-3(7,4(8,9)10)5(11,14-1-12)15-2-13/h3-7H,2H2,1H3; |
| InChIKey | KMTOGOIFIIZUIB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|