About (5-ethoxy-6-oxohexyl) formate
(5-ethoxy-6-oxohexyl) formate (PubChem CID 87933096) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is (5-ethoxy-6-oxohexyl) formate.
Molecular Properties
| Compound Name | (5-ethoxy-6-oxohexyl) formate |
| PubChem CID | 87933096 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (5-ethoxy-6-oxohexyl) formate |
| SMILES | CCOC(C=O)CCCCOC=O |
| InChI | InChI=1S/C9H16O4/c1-2-13-9(7-10)5-3-4-6-12-8-11/h7-9H,2-6H2,1H3 |
| InChIKey | ZZTBVFGQVKDLHF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5-ethoxy-6-oxohexyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethoxy-6-oxohexyl) formate?
The IUPAC name of (5-ethoxy-6-oxohexyl) formate (CID 87933096) is (5-ethoxy-6-oxohexyl) formate.
What is the SMILES notation for (5-ethoxy-6-oxohexyl) formate?
The canonical SMILES for (5-ethoxy-6-oxohexyl) formate is CCOC(C=O)CCCCOC=O.
What is the InChIKey of (5-ethoxy-6-oxohexyl) formate?
The InChIKey is ZZTBVFGQVKDLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-2-13-9(7-10)5-3-4-6-12-8-11/h7-9H,2-6H2,1H3.
What are the key properties of (5-ethoxy-6-oxohexyl) formate?
(5-ethoxy-6-oxohexyl) formate has a molecular weight of 188.22 g/mol, XLogP of 0.93, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethoxy-6-oxohexyl) formate is sourced from PubChem (CID 87933096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).